C18H17F3IN3O — CID 167460130
N-[3-cyclopropyl-4-(trifluoromethyl)phenyl]-1-(4-iodopyrazol-1-yl)cyclobutane-1-carboxamide (PubChem CID 167460130) has the molecular formula C18H17F3IN3O and a molecular weight of 475.25 g/mol. Its IUPAC name is N-[3-cyclopropyl-4-(trifluoromethyl)phenyl]-1-(4-iodopyrazol-1-yl)cyclobutane-1-carboxamide.
| Compound Name | N-[3-cyclopropyl-4-(trifluoromethyl)phenyl]-1-(4-iodopyrazol-1-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 167460130 |
| Molecular Formula | C18H17F3IN3O |
| Molecular Weight | 475.25 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | N-[3-cyclopropyl-4-(trifluoromethyl)phenyl]-1-(4-iodopyrazol-1-yl)cyclobutane-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)c(C2CC2)c1)C1(n2cc(I)cn2)CCC1 |
| InChI | InChI=1S/C18H17F3IN3O/c19-18(20,21)15-5-4-13(8-14(15)11-2-3-11)24-16(26)17(6-1-7-17)25-10-12(22)9-23-25/h4-5,8-11H,1-3,6-7H2,(H,24,26) |
| InChIKey | GMUYZNVIFNRUCF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.25 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|