C19H37NO4 — CID 167461656
tert-butyl 4-cyclopentyl-3-methylpiperidine-1-carboxylate;propane-2,2-diol (PubChem CID 167461656) has the molecular formula C19H37NO4 and a molecular weight of 343.51 g/mol. Its IUPAC name is tert-butyl 4-cyclopentyl-3-methylpiperidine-1-carboxylate;propane-2,2-diol.
| Compound Name | tert-butyl 4-cyclopentyl-3-methylpiperidine-1-carboxylate;propane-2,2-diol |
|---|---|
| PubChem CID | 167461656 |
| Molecular Formula | C19H37NO4 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | tert-butyl 4-cyclopentyl-3-methylpiperidine-1-carboxylate;propane-2,2-diol |
| SMILES | CC(C)(O)O.CC1CN(C(=O)OC(C)(C)C)CCC1C1CCCC1 |
| InChI | InChI=1S/C16H29NO2.C3H8O2/c1-12-11-17(15(18)19-16(2,3)4)10-9-14(12)13-7-5-6-8-13;1-3(2,4)5/h12-14H,5-11H2,1-4H3;4-5H,1-2H3 |
| InChIKey | PPENJOBCJDIGSM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|