C20H33NO4 — CID 167464128
3-[[4-(ethoxymethyl)cyclohexyl]methoxy]-N-(3-prop-2-enoylcyclobutyl)propanamide (PubChem CID 167464128) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is 3-[[4-(ethoxymethyl)cyclohexyl]methoxy]-N-(3-prop-2-enoylcyclobutyl)propanamide.
| Compound Name | 3-[[4-(ethoxymethyl)cyclohexyl]methoxy]-N-(3-prop-2-enoylcyclobutyl)propanamide |
|---|---|
| PubChem CID | 167464128 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 3-[[4-(ethoxymethyl)cyclohexyl]methoxy]-N-(3-prop-2-enoylcyclobutyl)propanamide |
| SMILES | C=CC(=O)C1CC(NC(=O)CCOCC2CCC(COCC)CC2)C1 |
| InChI | InChI=1S/C20H33NO4/c1-3-19(22)17-11-18(12-17)21-20(23)9-10-25-14-16-7-5-15(6-8-16)13-24-4-2/h3,15-18H,1,4-14H2,2H3,(H,21,23) |
| InChIKey | RTEIDYGRDMXIEJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|