C20H35NO4S — CID 170128889
N-(4-acetylcyclohexyl)-3-[[4-(methylsulfanyloxymethyl)cyclohexyl]methoxy]propanamide (PubChem CID 170128889) has the molecular formula C20H35NO4S and a molecular weight of 385.57 g/mol. Its IUPAC name is N-(4-acetylcyclohexyl)-3-[[4-(methylsulfanyloxymethyl)cyclohexyl]methoxy]propanamide.
| Compound Name | N-(4-acetylcyclohexyl)-3-[[4-(methylsulfanyloxymethyl)cyclohexyl]methoxy]propanamide |
|---|---|
| PubChem CID | 170128889 |
| Molecular Formula | C20H35NO4S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-(4-acetylcyclohexyl)-3-[[4-(methylsulfanyloxymethyl)cyclohexyl]methoxy]propanamide |
| SMILES | CSOCC1CCC(COCCC(=O)NC2CCC(C(C)=O)CC2)CC1 |
| InChI | InChI=1S/C20H35NO4S/c1-15(22)18-7-9-19(10-8-18)21-20(23)11-12-24-13-16-3-5-17(6-4-16)14-25-26-2/h16-19H,3-14H2,1-2H3,(H,21,23) |
| InChIKey | ZMCIYMKSKSNQAD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|