C15H26N2O5S — CID 170195015
N-(4-acetylcyclohexyl)-2-[2-[(2-methylsulfanyloxyacetyl)amino]ethoxy]acetamide (PubChem CID 170195015) has the molecular formula C15H26N2O5S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-(4-acetylcyclohexyl)-2-[2-[(2-methylsulfanyloxyacetyl)amino]ethoxy]acetamide.
| Compound Name | N-(4-acetylcyclohexyl)-2-[2-[(2-methylsulfanyloxyacetyl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 170195015 |
| Molecular Formula | C15H26N2O5S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(4-acetylcyclohexyl)-2-[2-[(2-methylsulfanyloxyacetyl)amino]ethoxy]acetamide |
| SMILES | CSOCC(=O)NCCOCC(=O)NC1CCC(C(C)=O)CC1 |
| InChI | InChI=1S/C15H26N2O5S/c1-11(18)12-3-5-13(6-4-12)17-15(20)9-21-8-7-16-14(19)10-22-23-2/h12-13H,3-10H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | PLKSWEIKEWNREA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|