C20H24N2O3S — CID 167465071
5-[2,3-bis(ethenyl)-6-[(E)-prop-1-enyl]thiopyran-4-ylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione;ethane (PubChem CID 167465071) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 5-[2,3-bis(ethenyl)-6-[(E)-prop-1-enyl]thiopyran-4-ylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione;ethane.
| Compound Name | 5-[2,3-bis(ethenyl)-6-[(E)-prop-1-enyl]thiopyran-4-ylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione;ethane |
|---|---|
| PubChem CID | 167465071 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 5-[2,3-bis(ethenyl)-6-[(E)-prop-1-enyl]thiopyran-4-ylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione;ethane |
| SMILES | C=CC1=C(C=C)C(=C2C(=O)N(C)C(=O)N(C)C2=O)C=C(/C=C/C)S1.CC |
| InChI | InChI=1S/C18H18N2O3S.C2H6/c1-6-9-11-10-13(12(7-2)14(8-3)24-11)15-16(21)19(4)18(23)20(5)17(15)22;1-2/h6-10H,2-3H2,1,4-5H3;1-2H3/b9-6+; |
| InChIKey | OXKFFIMADNJZQP-MLBSPLJJSA-N |
| XLogP | 4.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|