C28H38BrClF3N5O3 — CID 167467244
tert-butyl 5-[[(7-bromo-6-chloro-8-fluoro-2-methoxyquinazolin-4-yl)-methylamino]methyl]-3-fluoro-2-methylpyrrolidine-1-carboxylate;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 167467244) has the molecular formula C28H38BrClF3N5O3 and a molecular weight of 665.00 g/mol. Its IUPAC name is tert-butyl 5-[[(7-bromo-6-chloro-8-fluoro-2-methoxyquinazolin-4-yl)-methylamino]methyl]-3-fluoro-2-methylpyrrolidine-1-carboxylate;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | tert-butyl 5-[[(7-bromo-6-chloro-8-fluoro-2-methoxyquinazolin-4-yl)-methylamino]methyl]-3-fluoro-2-methylpyrrolidine-1-carboxylate;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 167467244 |
| Molecular Formula | C28H38BrClF3N5O3 |
| Molecular Weight | 665.00 g/mol |
| Exact Mass | 663.18 |
| IUPAC Name | tert-butyl 5-[[(7-bromo-6-chloro-8-fluoro-2-methoxyquinazolin-4-yl)-methylamino]methyl]-3-fluoro-2-methylpyrrolidine-1-carboxylate;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | COc1nc(N(C)CC2CC(F)C(C)N2C(=O)OC(C)(C)C)c2cc(Cl)c(Br)c(F)c2n1.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C21H26BrClF2N4O3.C7H12FN/c1-10-14(24)7-11(29(10)20(30)32-21(2,3)4)9-28(5)18-12-8-13(23)15(22)16(25)17(12)26-19(27-18)31-6;8-6-4-7-2-1-3-9(7)5-6/h8,10-11,14H,7,9H2,1-6H3;6-7H,1-5H2 |
| InChIKey | RHTXOCOJOQMOPS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.00 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|