C23H30F3N3O3 — CID 167467651
(2S)-N-[5-[2-[(3aR,6aS)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]-2-hydroxybutanamide (PubChem CID 167467651) has the molecular formula C23H30F3N3O3 and a molecular weight of 453.51 g/mol. Its IUPAC name is (2S)-N-[5-[2-[(3aR,6aS)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]-2-hydroxybutanamide.
| Compound Name | (2S)-N-[5-[2-[(3aR,6aS)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]-2-hydroxybutanamide |
|---|---|
| PubChem CID | 167467651 |
| Molecular Formula | C23H30F3N3O3 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (2S)-N-[5-[2-[(3aR,6aS)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]-2-hydroxybutanamide |
| SMILES | CC[C@H](O)C(=O)Nc1c[nH]c2ccc(OCCC3C[C@@H]4CN(CC(F)(F)F)C[C@@H]4C3)cc12 |
| InChI | InChI=1S/C23H30F3N3O3/c1-2-21(30)22(31)28-20-10-27-19-4-3-17(9-18(19)20)32-6-5-14-7-15-11-29(12-16(15)8-14)13-23(24,25)26/h3-4,9-10,14-16,21,27,30H,2,5-8,11-13H2,1H3,(H,28,31)/t14?,15-,16+,21-/m0/s1 |
| InChIKey | MXLKHTOSECBOMR-LHIKZTPXSA-N |
| XLogP | 4.17 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |