C27H34F3N3O2 — CID 170059801
(2R)-N-[5-[2-[(3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]bicyclo[3.1.1]heptane-2-carboxamide (PubChem CID 170059801) has the molecular formula C27H34F3N3O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is (2R)-N-[5-[2-[(3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]bicyclo[3.1.1]heptane-2-carboxamide.
| Compound Name | (2R)-N-[5-[2-[(3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]bicyclo[3.1.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 170059801 |
| Molecular Formula | C27H34F3N3O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | (2R)-N-[5-[2-[(3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]bicyclo[3.1.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1c[nH]c2ccc(OCCC3C[C@@H]4CN(CC(F)(F)F)C[C@@H]4C3)cc12)[C@@H]1CCC2CC1C2 |
| InChI | InChI=1S/C27H34F3N3O2/c28-27(29,30)15-33-13-19-9-17(10-20(19)14-33)5-6-35-21-2-4-24-23(11-21)25(12-31-24)32-26(34)22-3-1-16-7-18(22)8-16/h2,4,11-12,16-20,22,31H,1,3,5-10,13-15H2,(H,32,34)/t16?,17?,18?,19-,20+,22-/m1/s1 |
| InChIKey | HQVWELIHKOBTRU-WVJBXISRSA-N |
| XLogP | 5.83 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |