C11H15NO2 — CID 167471712
N-methyl-N-propan-2-yl-2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-amine (PubChem CID 167471712) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-methyl-N-propan-2-yl-2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-amine.
| Compound Name | N-methyl-N-propan-2-yl-2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-amine |
|---|---|
| PubChem CID | 167471712 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-methyl-N-propan-2-yl-2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-amine |
| SMILES | CC(C)N(C)c1ccc2cc1OCO2 |
| InChI | InChI=1S/C11H15NO2/c1-8(2)12(3)10-5-4-9-6-11(10)14-7-13-9/h4-6,8H,7H2,1-3H3 |
| InChIKey | LGXANIIZLROUTQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|