C10H12N2O2S — CID 141036083
1-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)-1-ethylthiourea (PubChem CID 141036083) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)-1-ethylthiourea.
| Compound Name | 1-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)-1-ethylthiourea |
|---|---|
| PubChem CID | 141036083 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)-1-ethylthiourea |
| SMILES | CCN(C(N)=S)c1ccc2cc1OCO2 |
| InChI | InChI=1S/C10H12N2O2S/c1-2-12(10(11)15)8-4-3-7-5-9(8)14-6-13-7/h3-5H,2,6H2,1H3,(H2,11,15) |
| InChIKey | SBDYORGRMREECN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|