C10H10O4 — CID 155797361
6-(oxiran-2-ylmethoxy)-2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-triene (PubChem CID 155797361) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 6-(oxiran-2-ylmethoxy)-2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-triene.
| Compound Name | 6-(oxiran-2-ylmethoxy)-2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-triene |
|---|---|
| PubChem CID | 155797361 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 6-(oxiran-2-ylmethoxy)-2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-triene |
| SMILES | c1cc(OCC2CO2)c2cc1OCO2 |
| InChI | InChI=1S/C10H10O4/c1-2-9(12-5-8-4-11-8)10-3-7(1)13-6-14-10/h1-3,8H,4-6H2 |
| InChIKey | HKBDTQLLLMPXMG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|