C32H48N2O6 — CID 167471725
[(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl 3-[2-(dimethylamino)-1,1-dihydroxyethyl]indole-1-carboxylate (PubChem CID 167471725) has the molecular formula C32H48N2O6 and a molecular weight of 556.74 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl 3-[2-(dimethylamino)-1,1-dihydroxyethyl]indole-1-carboxylate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl 3-[2-(dimethylamino)-1,1-dihydroxyethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 167471725 |
| Molecular Formula | C32H48N2O6 |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.35 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl 3-[2-(dimethylamino)-1,1-dihydroxyethyl]indole-1-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCOC(=O)n1cc(C(O)(O)CN(C)C)c2ccccc21 |
| InChI | InChI=1S/C32H48N2O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-30(35)39-26-40-31(36)34-24-28(32(37,38)25-33(2)3)27-21-19-20-22-29(27)34/h8-9,11-12,19-22,24,37-38H,4-7,10,13-18,23,25-26H2,1-3H3/b9-8-,12-11- |
| InChIKey | HUVWTCHFPOKVCF-MURFETPASA-N |
| XLogP | 6.64 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|