C31H34N4O3 — CID 167474015
4-[4-[(3-morpholin-4-ylphenyl)methoxy]phenyl]-N-(4-phenylbutyl)imidazole-1-carboxamide (PubChem CID 167474015) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is 4-[4-[(3-morpholin-4-ylphenyl)methoxy]phenyl]-N-(4-phenylbutyl)imidazole-1-carboxamide.
| Compound Name | 4-[4-[(3-morpholin-4-ylphenyl)methoxy]phenyl]-N-(4-phenylbutyl)imidazole-1-carboxamide |
|---|---|
| PubChem CID | 167474015 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 4-[4-[(3-morpholin-4-ylphenyl)methoxy]phenyl]-N-(4-phenylbutyl)imidazole-1-carboxamide |
| SMILES | O=C(NCCCCc1ccccc1)n1cnc(-c2ccc(OCc3cccc(N4CCOCC4)c3)cc2)c1 |
| InChI | InChI=1S/C31H34N4O3/c36-31(32-16-5-4-9-25-7-2-1-3-8-25)35-22-30(33-24-35)27-12-14-29(15-13-27)38-23-26-10-6-11-28(21-26)34-17-19-37-20-18-34/h1-3,6-8,10-15,21-22,24H,4-5,9,16-20,23H2,(H,32,36) |
| InChIKey | JZUQPZNQHFZKEZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|