C25H27N5O4S — CID 176736364
4-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]-N-(4-pyrazol-1-ylbutyl)imidazole-1-carboxamide (PubChem CID 176736364) has the molecular formula C25H27N5O4S and a molecular weight of 493.59 g/mol. Its IUPAC name is 4-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]-N-(4-pyrazol-1-ylbutyl)imidazole-1-carboxamide.
| Compound Name | 4-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]-N-(4-pyrazol-1-ylbutyl)imidazole-1-carboxamide |
|---|---|
| PubChem CID | 176736364 |
| Molecular Formula | C25H27N5O4S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 4-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]-N-(4-pyrazol-1-ylbutyl)imidazole-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(COc2ccc(-c3cn(C(=O)NCCCCn4cccn4)cn3)cc2)cc1 |
| InChI | InChI=1S/C25H27N5O4S/c1-35(32,33)23-11-5-20(6-12-23)18-34-22-9-7-21(8-10-22)24-17-29(19-27-24)25(31)26-13-2-3-15-30-16-4-14-28-30/h4-12,14,16-17,19H,2-3,13,15,18H2,1H3,(H,26,31) |
| InChIKey | ZWWHYKBYIWVTKZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|