C21H28N6O3S — CID 172574697
6-[4-[3-(methylamino)propoxy]phenyl]-2-methylsulfonyl-N-(3-pyrazol-1-ylpropyl)pyrimidin-4-amine (PubChem CID 172574697) has the molecular formula C21H28N6O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is 6-[4-[3-(methylamino)propoxy]phenyl]-2-methylsulfonyl-N-(3-pyrazol-1-ylpropyl)pyrimidin-4-amine.
| Compound Name | 6-[4-[3-(methylamino)propoxy]phenyl]-2-methylsulfonyl-N-(3-pyrazol-1-ylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 172574697 |
| Molecular Formula | C21H28N6O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 6-[4-[3-(methylamino)propoxy]phenyl]-2-methylsulfonyl-N-(3-pyrazol-1-ylpropyl)pyrimidin-4-amine |
| SMILES | CNCCCOc1ccc(-c2cc(NCCCn3cccn3)nc(S(C)(=O)=O)n2)cc1 |
| InChI | InChI=1S/C21H28N6O3S/c1-22-10-5-15-30-18-8-6-17(7-9-18)19-16-20(26-21(25-19)31(2,28)29)23-11-3-13-27-14-4-12-24-27/h4,6-9,12,14,16,22H,3,5,10-11,13,15H2,1-2H3,(H,23,25,26) |
| InChIKey | YGKWYKGQQSRPDR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|