C21H34F3N3O4 — CID 167481289
N-[(3R)-3-cyclopropyloxy-1-oxo-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]-2,2,2-trifluoroacetamide;N-propan-2-ylformamide (PubChem CID 167481289) has the molecular formula C21H34F3N3O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[(3R)-3-cyclopropyloxy-1-oxo-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]-2,2,2-trifluoroacetamide;N-propan-2-ylformamide.
| Compound Name | N-[(3R)-3-cyclopropyloxy-1-oxo-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]-2,2,2-trifluoroacetamide;N-propan-2-ylformamide |
|---|---|
| PubChem CID | 167481289 |
| Molecular Formula | C21H34F3N3O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | N-[(3R)-3-cyclopropyloxy-1-oxo-1-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]-2,2,2-trifluoroacetamide;N-propan-2-ylformamide |
| SMILES | CC(C)NC=O.C[C@@H]1C2C(CN1C(=O)C(NC(=O)C(F)(F)F)[C@@H](C)OC1CC1)C2(C)C |
| InChI | InChI=1S/C17H25F3N2O3.C4H9NO/c1-8-12-11(16(12,3)4)7-22(8)14(23)13(9(2)25-10-5-6-10)21-15(24)17(18,19)20;1-4(2)5-3-6/h8-13H,5-7H2,1-4H3,(H,21,24);3-4H,1-2H3,(H,5,6)/t8-,9-,11?,12?,13?;/m1./s1 |
| InChIKey | NXLAFKKXKCYKCL-YVWPZCDLSA-N |
| XLogP | 2.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|