C17H23F3N4O4 — CID 167521940
(1R,2S,5S)-N-(cyanomethyl)-3-[(2S,3R)-3-methoxy-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 167521940) has the molecular formula C17H23F3N4O4 and a molecular weight of 404.39 g/mol. Its IUPAC name is (1R,2S,5S)-N-(cyanomethyl)-3-[(2S,3R)-3-methoxy-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-(cyanomethyl)-3-[(2S,3R)-3-methoxy-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 167521940 |
| Molecular Formula | C17H23F3N4O4 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (1R,2S,5S)-N-(cyanomethyl)-3-[(2S,3R)-3-methoxy-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CO[C@H](C)[C@H](NC(=O)C(F)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NCC#N)C2(C)C |
| InChI | InChI=1S/C17H23F3N4O4/c1-8(28-4)11(23-15(27)17(18,19)20)14(26)24-7-9-10(16(9,2)3)12(24)13(25)22-6-5-21/h8-12H,6-7H2,1-4H3,(H,22,25)(H,23,27)/t8-,9+,10+,11+,12+/m1/s1 |
| InChIKey | VNTNNHVSRMQZDT-DGORSVRFSA-N |
| XLogP | 0.19 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|