C12H15NO — CID 167484187
(E,4E)-4-(4,5-dimethyl-1,3-dihydropyrrol-2-ylidene)-2-ethenylbut-2-enal (PubChem CID 167484187) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (E,4E)-4-(4,5-dimethyl-1,3-dihydropyrrol-2-ylidene)-2-ethenylbut-2-enal.
| Compound Name | (E,4E)-4-(4,5-dimethyl-1,3-dihydropyrrol-2-ylidene)-2-ethenylbut-2-enal |
|---|---|
| PubChem CID | 167484187 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (E,4E)-4-(4,5-dimethyl-1,3-dihydropyrrol-2-ylidene)-2-ethenylbut-2-enal |
| SMILES | C=C/C(C=O)=C\C=C1/CC(C)=C(C)N1 |
| InChI | InChI=1S/C12H15NO/c1-4-11(8-14)5-6-12-7-9(2)10(3)13-12/h4-6,8,13H,1,7H2,2-3H3/b11-5+,12-6+ |
| InChIKey | GBUQLMPJDJUVKX-YDWXAUTNSA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|