C18H24N4O4 — CID 16748483
ethyl 1-(2-hydroxy-2-phenylethyl)-5-(propan-2-ylcarbamoylamino)pyrazole-4-carboxylate (PubChem CID 16748483) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl 1-(2-hydroxy-2-phenylethyl)-5-(propan-2-ylcarbamoylamino)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(2-hydroxy-2-phenylethyl)-5-(propan-2-ylcarbamoylamino)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 16748483 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | ethyl 1-(2-hydroxy-2-phenylethyl)-5-(propan-2-ylcarbamoylamino)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(CC(O)c2ccccc2)c1NC(=O)NC(C)C |
| InChI | InChI=1S/C18H24N4O4/c1-4-26-17(24)14-10-19-22(16(14)21-18(25)20-12(2)3)11-15(23)13-8-6-5-7-9-13/h5-10,12,15,23H,4,11H2,1-3H3,(H2,20,21,25) |
| InChIKey | RXBGNQVESFBRNB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |