C50H41N3OY — CID 167485188
N-methyl-N-[2-(methylamino)-5-[10-[4-[(Z)-1-(methylideneamino)-3-phenyl-3-(2-phenylphenyl)prop-1-enyl]phenyl]anthracen-9-yl]phenyl]hydroxylamine;yttrium (PubChem CID 167485188) has the molecular formula C50H41N3OY and a molecular weight of 788.80 g/mol. Its IUPAC name is N-methyl-N-[2-(methylamino)-5-[10-[4-[(Z)-1-(methylideneamino)-3-phenyl-3-(2-phenylphenyl)prop-1-enyl]phenyl]anthracen-9-yl]phenyl]hydroxylamine;yttrium.
| Compound Name | N-methyl-N-[2-(methylamino)-5-[10-[4-[(Z)-1-(methylideneamino)-3-phenyl-3-(2-phenylphenyl)prop-1-enyl]phenyl]anthracen-9-yl]phenyl]hydroxylamine;yttrium |
|---|---|
| PubChem CID | 167485188 |
| Molecular Formula | C50H41N3OY |
| Molecular Weight | 788.80 g/mol |
| Exact Mass | 788.23 |
| IUPAC Name | N-methyl-N-[2-(methylamino)-5-[10-[4-[(Z)-1-(methylideneamino)-3-phenyl-3-(2-phenylphenyl)prop-1-enyl]phenyl]anthracen-9-yl]phenyl]hydroxylamine;yttrium |
| SMILES | C=N/C(=C\C(c1ccccc1)c1ccccc1-c1ccccc1)c1ccc(-c2c3ccccc3c(-c3ccc(NC)c(N(C)O)c3)c3ccccc23)cc1.[Y] |
| InChI | InChI=1S/C50H41N3O.Y/c1-51-46-31-30-38(32-48(46)53(3)54)50-43-24-14-12-22-41(43)49(42-23-13-15-25-44(42)50)37-28-26-36(27-29-37)47(52-2)33-45(35-18-8-5-9-19-35)40-21-11-10-20-39(40)34-16-6-4-7-17-34;/h4-33,45,51,54H,2H2,1,3H3;/b47-33-; |
| InChIKey | GIGQWLBSXLFUKW-QIXMSHGVSA-N |
| XLogP | 12.73 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.80 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|