C51H41N5O — CID 167485149
N-methyl-N-[2-(methylamino)-4-[10-[3-[N'-[N-(1-phenylethenyl)-C-(2-phenylphenyl)carbonimidoyl]carbamimidoyl]phenyl]anthracen-9-yl]phenyl]formamide (PubChem CID 167485149) has the molecular formula C51H41N5O and a molecular weight of 739.92 g/mol. Its IUPAC name is N-methyl-N-[2-(methylamino)-4-[10-[3-[N'-[N-(1-phenylethenyl)-C-(2-phenylphenyl)carbonimidoyl]carbamimidoyl]phenyl]anthracen-9-yl]phenyl]formamide.
| Compound Name | N-methyl-N-[2-(methylamino)-4-[10-[3-[N'-[N-(1-phenylethenyl)-C-(2-phenylphenyl)carbonimidoyl]carbamimidoyl]phenyl]anthracen-9-yl]phenyl]formamide |
|---|---|
| PubChem CID | 167485149 |
| Molecular Formula | C51H41N5O |
| Molecular Weight | 739.92 g/mol |
| Exact Mass | 739.33 |
| IUPAC Name | N-methyl-N-[2-(methylamino)-4-[10-[3-[N'-[N-(1-phenylethenyl)-C-(2-phenylphenyl)carbonimidoyl]carbamimidoyl]phenyl]anthracen-9-yl]phenyl]formamide |
| SMILES | C=C(/N=C(/N=C(\N)c1cccc(-c2c3ccccc3c(-c3ccc(N(C)C=O)c(NC)c3)c3ccccc23)c1)c1ccccc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H41N5O/c1-34(35-17-6-4-7-18-35)54-51(45-28-15-10-23-40(45)36-19-8-5-9-20-36)55-50(52)39-22-16-21-37(31-39)48-41-24-11-13-26-43(41)49(44-27-14-12-25-42(44)48)38-29-30-47(56(3)33-57)46(32-38)53-2/h4-33,53H,1H2,2-3H3,(H2,52,54,55) |
| InChIKey | GWQHFMVUNBSAMW-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.92 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|