C51H45N3OY — CID 167485295
N-methyl-N-[2-(methylamino)-5-[10-[4-[(Z)-1-(methylideneamino)-3-(3-phenylphenyl)prop-1-enyl]phenyl]anthracen-9-yl]phenyl]hydroxylamine;toluene;yttrium (PubChem CID 167485295) has the molecular formula C51H45N3OY and a molecular weight of 804.85 g/mol. Its IUPAC name is N-methyl-N-[2-(methylamino)-5-[10-[4-[(Z)-1-(methylideneamino)-3-(3-phenylphenyl)prop-1-enyl]phenyl]anthracen-9-yl]phenyl]hydroxylamine;toluene;yttrium.
| Compound Name | N-methyl-N-[2-(methylamino)-5-[10-[4-[(Z)-1-(methylideneamino)-3-(3-phenylphenyl)prop-1-enyl]phenyl]anthracen-9-yl]phenyl]hydroxylamine;toluene;yttrium |
|---|---|
| PubChem CID | 167485295 |
| Molecular Formula | C51H45N3OY |
| Molecular Weight | 804.85 g/mol |
| Exact Mass | 804.26 |
| IUPAC Name | N-methyl-N-[2-(methylamino)-5-[10-[4-[(Z)-1-(methylideneamino)-3-(3-phenylphenyl)prop-1-enyl]phenyl]anthracen-9-yl]phenyl]hydroxylamine;toluene;yttrium |
| SMILES | C=N/C(=C\Cc1cccc(-c2ccccc2)c1)c1ccc(-c2c3ccccc3c(-c3ccc(NC)c(N(C)O)c3)c3ccccc23)cc1.Cc1ccccc1.[Y] |
| InChI | InChI=1S/C44H37N3O.C7H8.Y/c1-45-40(26-20-30-12-11-15-34(28-30)31-13-5-4-6-14-31)32-21-23-33(24-22-32)43-36-16-7-9-18-38(36)44(39-19-10-8-17-37(39)43)35-25-27-41(46-2)42(29-35)47(3)48;1-7-5-3-2-4-6-7;/h4-19,21-29,46,48H,1,20H2,2-3H3;2-6H,1H3;/b40-26-;; |
| InChIKey | FSAZQRFNQFNWFL-YMYFJESHSA-N |
| XLogP | 13.14 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.85 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|