C28H23Cl2N — CID 135245561
(Z)-N-benzyl-1-(3,5-dichlorophenyl)-3-(3-phenylphenyl)prop-1-en-1-amine (PubChem CID 135245561) has the molecular formula C28H23Cl2N and a molecular weight of 444.41 g/mol. Its IUPAC name is (Z)-N-benzyl-1-(3,5-dichlorophenyl)-3-(3-phenylphenyl)prop-1-en-1-amine.
| Compound Name | (Z)-N-benzyl-1-(3,5-dichlorophenyl)-3-(3-phenylphenyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 135245561 |
| Molecular Formula | C28H23Cl2N |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (Z)-N-benzyl-1-(3,5-dichlorophenyl)-3-(3-phenylphenyl)prop-1-en-1-amine |
| SMILES | Clc1cc(Cl)cc(/C(=C/Cc2cccc(-c3ccccc3)c2)NCc2ccccc2)c1 |
| InChI | InChI=1S/C28H23Cl2N/c29-26-17-25(18-27(30)19-26)28(31-20-22-8-3-1-4-9-22)15-14-21-10-7-13-24(16-21)23-11-5-2-6-12-23/h1-13,15-19,31H,14,20H2/b28-15- |
| InChIKey | ZQWKYEGKNHMTKQ-MBTHVWNTSA-N |
| XLogP | 8.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |