C29H25Cl — CID 145174310
1-chloro-3-[(E)-pent-2-en-2-yl]-5-[4-(3-phenylphenyl)phenyl]benzene (PubChem CID 145174310) has the molecular formula C29H25Cl and a molecular weight of 408.97 g/mol. Its IUPAC name is 1-chloro-3-[(E)-pent-2-en-2-yl]-5-[4-(3-phenylphenyl)phenyl]benzene.
| Compound Name | 1-chloro-3-[(E)-pent-2-en-2-yl]-5-[4-(3-phenylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 145174310 |
| Molecular Formula | C29H25Cl |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-chloro-3-[(E)-pent-2-en-2-yl]-5-[4-(3-phenylphenyl)phenyl]benzene |
| SMILES | CC/C=C(\C)c1cc(Cl)cc(-c2ccc(-c3cccc(-c4ccccc4)c3)cc2)c1 |
| InChI | InChI=1S/C29H25Cl/c1-3-8-21(2)27-18-28(20-29(30)19-27)24-15-13-23(14-16-24)26-12-7-11-25(17-26)22-9-5-4-6-10-22/h4-20H,3H2,1-2H3/b21-8+ |
| InChIKey | ITUVJQFFSMDTBX-ODCIPOBUSA-N |
| XLogP | 9.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |