C49H43N3O — CID 167485040
N-[5-[4-[(Z)-3-[4-[7,8-bis(ethenyl)phenanthren-2-yl]phenyl]-1-(methylideneamino)-3-phenylbut-1-enyl]phenyl]-2-(methylamino)phenyl]-N-methylhydroxylamine (PubChem CID 167485040) has the molecular formula C49H43N3O and a molecular weight of 689.90 g/mol. Its IUPAC name is N-[5-[4-[(Z)-3-[4-[7,8-bis(ethenyl)phenanthren-2-yl]phenyl]-1-(methylideneamino)-3-phenylbut-1-enyl]phenyl]-2-(methylamino)phenyl]-N-methylhydroxylamine.
| Compound Name | N-[5-[4-[(Z)-3-[4-[7,8-bis(ethenyl)phenanthren-2-yl]phenyl]-1-(methylideneamino)-3-phenylbut-1-enyl]phenyl]-2-(methylamino)phenyl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 167485040 |
| Molecular Formula | C49H43N3O |
| Molecular Weight | 689.90 g/mol |
| Exact Mass | 689.34 |
| IUPAC Name | N-[5-[4-[(Z)-3-[4-[7,8-bis(ethenyl)phenanthren-2-yl]phenyl]-1-(methylideneamino)-3-phenylbut-1-enyl]phenyl]-2-(methylamino)phenyl]-N-methylhydroxylamine |
| SMILES | C=Cc1ccc2c(ccc3cc(-c4ccc(C(C)(/C=C(\N=C)c5ccc(-c6ccc(NC)c(N(C)O)c6)cc5)c5ccccc5)cc4)ccc32)c1C=C |
| InChI | InChI=1S/C49H43N3O/c1-7-33-20-27-45-43-26-21-37(30-39(43)22-28-44(45)42(33)8-2)35-18-24-41(25-19-35)49(3,40-12-10-9-11-13-40)32-47(51-5)36-16-14-34(15-17-36)38-23-29-46(50-4)48(31-38)52(6)53/h7-32,50,53H,1-2,5H2,3-4,6H3/b47-32- |
| InChIKey | DBTFOSDKUFSPFA-WPGMWTCCSA-N |
| XLogP | 12.53 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.90 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|