C48H43N3 — CID 145334965
(2Z)-2-methyl-N'-[4-[4-[(Z)-1-(methylideneamino)-3-phenyl-3-(4-phenylphenyl)but-1-enyl]phenyl]phenyl]-3-(2-methylphenyl)penta-2,4-dienimidamide (PubChem CID 145334965) has the molecular formula C48H43N3 and a molecular weight of 661.89 g/mol. Its IUPAC name is (2Z)-2-methyl-N'-[4-[4-[(Z)-1-(methylideneamino)-3-phenyl-3-(4-phenylphenyl)but-1-enyl]phenyl]phenyl]-3-(2-methylphenyl)penta-2,4-dienimidamide.
| Compound Name | (2Z)-2-methyl-N'-[4-[4-[(Z)-1-(methylideneamino)-3-phenyl-3-(4-phenylphenyl)but-1-enyl]phenyl]phenyl]-3-(2-methylphenyl)penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 145334965 |
| Molecular Formula | C48H43N3 |
| Molecular Weight | 661.89 g/mol |
| Exact Mass | 661.35 |
| IUPAC Name | (2Z)-2-methyl-N'-[4-[4-[(Z)-1-(methylideneamino)-3-phenyl-3-(4-phenylphenyl)but-1-enyl]phenyl]phenyl]-3-(2-methylphenyl)penta-2,4-dienimidamide |
| SMILES | C=C/C(=C(C)/C(N)=N/c1ccc(-c2ccc(/C(=C/C(C)(c3ccccc3)c3ccc(-c4ccccc4)cc3)N=C)cc2)cc1)c1ccccc1C |
| InChI | InChI=1S/C48H43N3/c1-6-44(45-20-14-13-15-34(45)2)35(3)47(49)51-43-31-27-39(28-32-43)37-21-23-40(24-22-37)46(50-5)33-48(4,41-18-11-8-12-19-41)42-29-25-38(26-30-42)36-16-9-7-10-17-36/h6-33H,1,5H2,2-4H3,(H2,49,51)/b44-35-,46-33- |
| InChIKey | WYAXXIQOOZGOPV-QRJVEYPFSA-N |
| XLogP | 12.03 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.89 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|