C23H29BrN6O3 — CID 167487307
3-[3-[2-[[(2S)-2-[[(E)-4-bromobut-2-enoyl]-methylamino]propanoyl]amino]ethyl]anilino]-5,6-dimethylpyrazine-2-carboxamide (PubChem CID 167487307) has the molecular formula C23H29BrN6O3 and a molecular weight of 517.43 g/mol. Its IUPAC name is 3-[3-[2-[[(2S)-2-[[(E)-4-bromobut-2-enoyl]-methylamino]propanoyl]amino]ethyl]anilino]-5,6-dimethylpyrazine-2-carboxamide.
| Compound Name | 3-[3-[2-[[(2S)-2-[[(E)-4-bromobut-2-enoyl]-methylamino]propanoyl]amino]ethyl]anilino]-5,6-dimethylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167487307 |
| Molecular Formula | C23H29BrN6O3 |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 3-[3-[2-[[(2S)-2-[[(E)-4-bromobut-2-enoyl]-methylamino]propanoyl]amino]ethyl]anilino]-5,6-dimethylpyrazine-2-carboxamide |
| SMILES | Cc1nc(Nc2cccc(CCNC(=O)[C@H](C)N(C)C(=O)/C=C/CBr)c2)c(C(N)=O)nc1C |
| InChI | InChI=1S/C23H29BrN6O3/c1-14-15(2)28-22(20(27-14)21(25)32)29-18-8-5-7-17(13-18)10-12-26-23(33)16(3)30(4)19(31)9-6-11-24/h5-9,13,16H,10-12H2,1-4H3,(H2,25,32)(H,26,33)(H,28,29)/b9-6+/t16-/m0/s1 |
| InChIKey | DVSPHXKENGFDJE-FSNWXROXSA-N |
| XLogP | 2.39 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|