C24H34BrN7O3 — CID 168970555
(E)-4-bromo-N-ethyl-N-methylbut-2-enamide;5-(dimethylamino)-3-[3-(2-formamidoethyl)anilino]-6-methylpyrazine-2-carboxamide (PubChem CID 168970555) has the molecular formula C24H34BrN7O3 and a molecular weight of 548.49 g/mol. Its IUPAC name is (E)-4-bromo-N-ethyl-N-methylbut-2-enamide;5-(dimethylamino)-3-[3-(2-formamidoethyl)anilino]-6-methylpyrazine-2-carboxamide.
| Compound Name | (E)-4-bromo-N-ethyl-N-methylbut-2-enamide;5-(dimethylamino)-3-[3-(2-formamidoethyl)anilino]-6-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168970555 |
| Molecular Formula | C24H34BrN7O3 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | (E)-4-bromo-N-ethyl-N-methylbut-2-enamide;5-(dimethylamino)-3-[3-(2-formamidoethyl)anilino]-6-methylpyrazine-2-carboxamide |
| SMILES | CCN(C)C(=O)/C=C/CBr.Cc1nc(C(N)=O)c(Nc2cccc(CCNC=O)c2)nc1N(C)C |
| InChI | InChI=1S/C17H22N6O2.C7H12BrNO/c1-11-17(23(2)3)22-16(14(20-11)15(18)25)21-13-6-4-5-12(9-13)7-8-19-10-24;1-3-9(2)7(10)5-4-6-8/h4-6,9-10H,7-8H2,1-3H3,(H2,18,25)(H,19,24)(H,21,22);4-5H,3,6H2,1-2H3/b;5-4+ |
| InChIKey | DCEGKQHBZJKSLD-RCKHEGBHSA-N |
| XLogP | 2.40 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|