ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate

C25H21NO3 — CID 167491875

IUPACethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate
SMILESCCOC(=O)c1nc2cccc(-c3ccccc3)c2cc1OCc1ccccc1
InChIInChI=1S/C25H21NO3/c1-2-28-25(27)24-23(29-17-18-10-5-3-6-11-18)16-21-20(14-9-15-22(21)26-24)19-12-7-4-8-13-19/h3-16H,2,17H2,1H3
InChIKeyGYJDDDOTCMIXTE-UHFFFAOYSA-N
MW383.45 g/mol
LogP5.66
Rot. Bonds6

About ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate

ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate (PubChem CID 167491875) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate.

Molecular Properties

Compound Nameethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate
PubChem CID167491875
Molecular FormulaC25H21NO3
Molecular Weight383.45 g/mol
Exact Mass383.15
IUPAC Nameethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate
SMILESCCOC(=O)c1nc2cccc(-c3ccccc3)c2cc1OCc1ccccc1
InChIInChI=1S/C25H21NO3/c1-2-28-25(27)24-23(29-17-18-10-5-3-6-11-18)16-21-20(14-9-15-22(21)26-24)19-12-7-4-8-13-19/h3-16H,2,17H2,1H3
InChIKeyGYJDDDOTCMIXTE-UHFFFAOYSA-N
XLogP5.66
TPSA48.42 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500383.45
LogP ≤ 55.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate?
The IUPAC name of ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate (CID 167491875) is ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate.
What is the SMILES notation for ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate?
The canonical SMILES for ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate is CCOC(=O)c1nc2cccc(-c3ccccc3)c2cc1OCc1ccccc1.
What is the InChIKey of ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate?
The InChIKey is GYJDDDOTCMIXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21NO3/c1-2-28-25(27)24-23(29-17-18-10-5-3-6-11-18)16-21-20(14-9-15-22(21)26-24)19-12-7-4-8-13-19/h3-16H,2,17H2,1H3.
What are the key properties of ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate?
ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate has a molecular weight of 383.45 g/mol, XLogP of 5.66, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-phenyl-3-phenylmethoxyquinoline-2-carboxylate is sourced from PubChem (CID 167491875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).