C19H23F3N2O — CID 167492934
2-[N-[(E)-3-aminobut-2-enyl]-C-[(2E,4Z)-hepta-2,4-dien-2-yl]carbonimidoyl]-5-(trifluoromethyl)phenol (PubChem CID 167492934) has the molecular formula C19H23F3N2O and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-[N-[(E)-3-aminobut-2-enyl]-C-[(2E,4Z)-hepta-2,4-dien-2-yl]carbonimidoyl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[N-[(E)-3-aminobut-2-enyl]-C-[(2E,4Z)-hepta-2,4-dien-2-yl]carbonimidoyl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 167492934 |
| Molecular Formula | C19H23F3N2O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-[N-[(E)-3-aminobut-2-enyl]-C-[(2E,4Z)-hepta-2,4-dien-2-yl]carbonimidoyl]-5-(trifluoromethyl)phenol |
| SMILES | CC/C=C\C=C(C)\C(=N/C/C=C(\C)N)c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C19H23F3N2O/c1-4-5-6-7-13(2)18(24-11-10-14(3)23)16-9-8-15(12-17(16)25)19(20,21)22/h5-10,12,25H,4,11,23H2,1-3H3/b6-5-,13-7+,14-10+,24-18+ |
| InChIKey | GTHQOYIJOWTDNS-UJJMZJNZSA-N |
| XLogP | 4.98 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|