C20H25F3N2O — CID 167492738
2-[N-[(E)-3-aminobut-2-enyl]-C-[(2E,4Z)-3-methylhepta-2,4-dien-2-yl]carbonimidoyl]-5-(trifluoromethyl)phenol (PubChem CID 167492738) has the molecular formula C20H25F3N2O and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-[N-[(E)-3-aminobut-2-enyl]-C-[(2E,4Z)-3-methylhepta-2,4-dien-2-yl]carbonimidoyl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[N-[(E)-3-aminobut-2-enyl]-C-[(2E,4Z)-3-methylhepta-2,4-dien-2-yl]carbonimidoyl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 167492738 |
| Molecular Formula | C20H25F3N2O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-[N-[(E)-3-aminobut-2-enyl]-C-[(2E,4Z)-3-methylhepta-2,4-dien-2-yl]carbonimidoyl]-5-(trifluoromethyl)phenol |
| SMILES | CC/C=C\C(C)=C(C)\C(=N/C/C=C(\C)N)c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C20H25F3N2O/c1-5-6-7-13(2)15(4)19(25-11-10-14(3)24)17-9-8-16(12-18(17)26)20(21,22)23/h6-10,12,26H,5,11,24H2,1-4H3/b7-6-,14-10+,15-13+,25-19+ |
| InChIKey | NDEAJUORCBJKSF-VIGVMKCBSA-N |
| XLogP | 5.37 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|