C15H15F3 — CID 166855001
1-[(3E,5Z)-octa-1,3,5-trien-4-yl]-3-(trifluoromethyl)benzene (PubChem CID 166855001) has the molecular formula C15H15F3 and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-[(3E,5Z)-octa-1,3,5-trien-4-yl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-[(3E,5Z)-octa-1,3,5-trien-4-yl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 166855001 |
| Molecular Formula | C15H15F3 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-[(3E,5Z)-octa-1,3,5-trien-4-yl]-3-(trifluoromethyl)benzene |
| SMILES | C=C/C=C(\C=C/CC)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3/c1-3-5-8-12(7-4-2)13-9-6-10-14(11-13)15(16,17)18/h4-11H,2-3H2,1H3/b8-5-,12-7+ |
| InChIKey | DTNFSRIYCXRGFU-VKLFPMIUSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|