C13H12F3N — CID 162594183
(3E)-4-[3-(trifluoromethyl)phenyl]hexa-3,5-dien-2-imine (PubChem CID 162594183) has the molecular formula C13H12F3N and a molecular weight of 239.24 g/mol. Its IUPAC name is (3E)-4-[3-(trifluoromethyl)phenyl]hexa-3,5-dien-2-imine.
| Compound Name | (3E)-4-[3-(trifluoromethyl)phenyl]hexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 162594183 |
| Molecular Formula | C13H12F3N |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (3E)-4-[3-(trifluoromethyl)phenyl]hexa-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C=C(\C=C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F3N/c1-3-10(7-9(2)17)11-5-4-6-12(8-11)13(14,15)16/h3-8,17H,1H2,2H3/b10-7+,17-9+ |
| InChIKey | NABGNMZXPXKNMJ-ZIZOMIGWSA-N |
| XLogP | 4.31 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|