C22H27F3N2 — CID 144776362
ethane;(2E,4E,6E)-4-ethenyl-3-ethyl-2-(methylamino)-6-[3-(trifluoromethyl)phenyl]octa-2,4,6-trienenitrile (PubChem CID 144776362) has the molecular formula C22H27F3N2 and a molecular weight of 376.47 g/mol. Its IUPAC name is ethane;(2E,4E,6E)-4-ethenyl-3-ethyl-2-(methylamino)-6-[3-(trifluoromethyl)phenyl]octa-2,4,6-trienenitrile.
| Compound Name | ethane;(2E,4E,6E)-4-ethenyl-3-ethyl-2-(methylamino)-6-[3-(trifluoromethyl)phenyl]octa-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 144776362 |
| Molecular Formula | C22H27F3N2 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | ethane;(2E,4E,6E)-4-ethenyl-3-ethyl-2-(methylamino)-6-[3-(trifluoromethyl)phenyl]octa-2,4,6-trienenitrile |
| SMILES | C=CC(=C\C(=C/C)c1cccc(C(F)(F)F)c1)/C(CC)=C(\C#N)NC.CC |
| InChI | InChI=1S/C20H21F3N2.C2H6/c1-5-14(16-9-8-10-17(12-16)20(21,22)23)11-15(6-2)18(7-3)19(13-24)25-4;1-2/h5-6,8-12,25H,2,7H2,1,3-4H3;1-2H3/b14-5+,15-11+,19-18+; |
| InChIKey | UZAOOIUXVMFVOD-RMBYEKRHSA-N |
| XLogP | 6.65 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|