C16H17F3N2O3 — CID 144673212
2-[[(Z)-2-methyliminohex-3-enyl]carbamoyl]-5-(trifluoromethyl)benzoic acid (PubChem CID 144673212) has the molecular formula C16H17F3N2O3 and a molecular weight of 342.32 g/mol. Its IUPAC name is 2-[[(Z)-2-methyliminohex-3-enyl]carbamoyl]-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[[(Z)-2-methyliminohex-3-enyl]carbamoyl]-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 144673212 |
| Molecular Formula | C16H17F3N2O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[[(Z)-2-methyliminohex-3-enyl]carbamoyl]-5-(trifluoromethyl)benzoic acid |
| SMILES | CC/C=C\C(CNC(=O)c1ccc(C(F)(F)F)cc1C(=O)O)=N/C |
| InChI | InChI=1S/C16H17F3N2O3/c1-3-4-5-11(20-2)9-21-14(22)12-7-6-10(16(17,18)19)8-13(12)15(23)24/h4-8H,3,9H2,1-2H3,(H,21,22)(H,23,24)/b5-4-,20-11+ |
| InChIKey | AUMNVBGWGSKRHF-OIFBWDNZSA-N |
| XLogP | 3.17 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|