C28H35N3O2S — CID 167493535
CID 167493535 (PubChem CID 167493535) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol.
| Compound Name | CID 167493535 |
|---|---|
| PubChem CID | 167493535 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | — |
| SMILES | CSNc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1cccc([C@H](O)C2CCCC2)n1 |
| InChI | InChI=1S/C28H35N3O2S/c1-34-30-20-9-10-24-21(17-20)28(15-13-27(11-12-27)14-16-28)18-31(24)26(33)23-8-4-7-22(29-23)25(32)19-5-2-3-6-19/h4,7-10,17,19,25,30,32H,2-3,5-6,11-16,18H2,1H3/t25-/m1/s1 |
| InChIKey | DYRNTIQZSVDSQK-RUZDIDTESA-N |
| XLogP | 6.25 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|