C11H10Cl2N2O4 — CID 167494607
ethyl 2-[2,6-dichloro-5-(1,3-dioxol-2-yl)pyrimidin-4-yl]acetate (PubChem CID 167494607) has the molecular formula C11H10Cl2N2O4 and a molecular weight of 305.12 g/mol. Its IUPAC name is ethyl 2-[2,6-dichloro-5-(1,3-dioxol-2-yl)pyrimidin-4-yl]acetate.
| Compound Name | ethyl 2-[2,6-dichloro-5-(1,3-dioxol-2-yl)pyrimidin-4-yl]acetate |
|---|---|
| PubChem CID | 167494607 |
| Molecular Formula | C11H10Cl2N2O4 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | ethyl 2-[2,6-dichloro-5-(1,3-dioxol-2-yl)pyrimidin-4-yl]acetate |
| SMILES | CCOC(=O)Cc1nc(Cl)nc(Cl)c1C1OC=CO1 |
| InChI | InChI=1S/C11H10Cl2N2O4/c1-2-17-7(16)5-6-8(10-18-3-4-19-10)9(12)15-11(13)14-6/h3-4,10H,2,5H2,1H3 |
| InChIKey | KAQFFMLVMJSULN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |