C19H32O4Si2 — CID 16749509
(4aR,8R,8aR)-3,8,8a-trimethyl-6,8-bis(trimethylsilyloxy)-4a,5-dihydronaphthalene-1,4-dione (PubChem CID 16749509) has the molecular formula C19H32O4Si2 and a molecular weight of 380.63 g/mol. Its IUPAC name is (4aR,8R,8aR)-3,8,8a-trimethyl-6,8-bis(trimethylsilyloxy)-4a,5-dihydronaphthalene-1,4-dione.
| Compound Name | (4aR,8R,8aR)-3,8,8a-trimethyl-6,8-bis(trimethylsilyloxy)-4a,5-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 16749509 |
| Molecular Formula | C19H32O4Si2 |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (4aR,8R,8aR)-3,8,8a-trimethyl-6,8-bis(trimethylsilyloxy)-4a,5-dihydronaphthalene-1,4-dione |
| SMILES | CC1=CC(=O)[C@]2(C)[C@@H](CC(O[Si](C)(C)C)=C[C@@]2(C)O[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C19H32O4Si2/c1-13-10-16(20)19(3)15(17(13)21)11-14(22-24(4,5)6)12-18(19,2)23-25(7,8)9/h10,12,15H,11H2,1-9H3/t15-,18+,19-/m0/s1 |
| InChIKey | IKJYHIMBSQCQSK-IPELMVKDSA-N |
| XLogP | 4.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|