C16H18ClFO3 — CID 167498248
ethyl 3-(2-chloro-4-fluorophenyl)-3-oxopropanoate;(3Z)-penta-1,3-diene (PubChem CID 167498248) has the molecular formula C16H18ClFO3 and a molecular weight of 312.77 g/mol. Its IUPAC name is ethyl 3-(2-chloro-4-fluorophenyl)-3-oxopropanoate;(3Z)-penta-1,3-diene.
| Compound Name | ethyl 3-(2-chloro-4-fluorophenyl)-3-oxopropanoate;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 167498248 |
| Molecular Formula | C16H18ClFO3 |
| Molecular Weight | 312.77 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | ethyl 3-(2-chloro-4-fluorophenyl)-3-oxopropanoate;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.CCOC(=O)CC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C11H10ClFO3.C5H8/c1-2-16-11(15)6-10(14)8-4-3-7(13)5-9(8)12;1-3-5-4-2/h3-5H,2,6H2,1H3;3-5H,1H2,2H3/b;5-4- |
| InChIKey | JGTHGSIVLJBTDB-GUHKXDMSSA-N |
| XLogP | 4.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.77 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|