C25H30N2O2 — CID 167498634
N-ethyl-2-methyl-3-[4-(2-methylphenyl)-1-oxo-2H-isoquinolin-7-yl]-N-propylpropanamide (PubChem CID 167498634) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-ethyl-2-methyl-3-[4-(2-methylphenyl)-1-oxo-2H-isoquinolin-7-yl]-N-propylpropanamide.
| Compound Name | N-ethyl-2-methyl-3-[4-(2-methylphenyl)-1-oxo-2H-isoquinolin-7-yl]-N-propylpropanamide |
|---|---|
| PubChem CID | 167498634 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-ethyl-2-methyl-3-[4-(2-methylphenyl)-1-oxo-2H-isoquinolin-7-yl]-N-propylpropanamide |
| SMILES | CCCN(CC)C(=O)C(C)Cc1ccc2c(-c3ccccc3C)c[nH]c(=O)c2c1 |
| InChI | InChI=1S/C25H30N2O2/c1-5-13-27(6-2)25(29)18(4)14-19-11-12-21-22(15-19)24(28)26-16-23(21)20-10-8-7-9-17(20)3/h7-12,15-16,18H,5-6,13-14H2,1-4H3,(H,26,28) |
| InChIKey | BHLCAAHSXHGTRR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |