C13H23NO2 — CID 167499548
6-hydroxy-N-propyldeca-2,4-dienamide (PubChem CID 167499548) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 6-hydroxy-N-propyldeca-2,4-dienamide.
| Compound Name | 6-hydroxy-N-propyldeca-2,4-dienamide |
|---|---|
| PubChem CID | 167499548 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 6-hydroxy-N-propyldeca-2,4-dienamide |
| SMILES | CCCCC(O)C=CC=CC(=O)NCCC |
| InChI | InChI=1S/C13H23NO2/c1-3-5-8-12(15)9-6-7-10-13(16)14-11-4-2/h6-7,9-10,12,15H,3-5,8,11H2,1-2H3,(H,14,16) |
| InChIKey | FZUIDJKSEZYCCQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|