C8H7FNPS — CID 167500583
(4-fluoro-2-methyl-1,3-benzothiazol-6-yl)phosphane (PubChem CID 167500583) has the molecular formula C8H7FNPS and a molecular weight of 199.19 g/mol. Its IUPAC name is (4-fluoro-2-methyl-1,3-benzothiazol-6-yl)phosphane.
| Compound Name | (4-fluoro-2-methyl-1,3-benzothiazol-6-yl)phosphane |
|---|---|
| PubChem CID | 167500583 |
| Molecular Formula | C8H7FNPS |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | (4-fluoro-2-methyl-1,3-benzothiazol-6-yl)phosphane |
| SMILES | Cc1nc2c(F)cc(P)cc2s1 |
| InChI | InChI=1S/C8H7FNPS/c1-4-10-8-6(9)2-5(11)3-7(8)12-4/h2-3H,11H2,1H3 |
| InChIKey | FPMVYABWIMAYLY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|