C15H25BrCl2N2O — CID 167500740
(2R)-N-[(2R)-2-aminopropyl]-N-benzyl-2-bromo-3-methylbutanamide;dihydrochloride (PubChem CID 167500740) has the molecular formula C15H25BrCl2N2O and a molecular weight of 400.19 g/mol. Its IUPAC name is (2R)-N-[(2R)-2-aminopropyl]-N-benzyl-2-bromo-3-methylbutanamide;dihydrochloride.
| Compound Name | (2R)-N-[(2R)-2-aminopropyl]-N-benzyl-2-bromo-3-methylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 167500740 |
| Molecular Formula | C15H25BrCl2N2O |
| Molecular Weight | 400.19 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | (2R)-N-[(2R)-2-aminopropyl]-N-benzyl-2-bromo-3-methylbutanamide;dihydrochloride |
| SMILES | CC(C)[C@@H](Br)C(=O)N(Cc1ccccc1)C[C@@H](C)N.Cl.Cl |
| InChI | InChI=1S/C15H23BrN2O.2ClH/c1-11(2)14(16)15(19)18(9-12(3)17)10-13-7-5-4-6-8-13;;/h4-8,11-12,14H,9-10,17H2,1-3H3;2*1H/t12-,14-;;/m1../s1 |
| InChIKey | FZWWNYMDYLDZNQ-OJNIYTAOSA-N |
| XLogP | 3.63 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|