About N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine
N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine (PubChem CID 167503143) has the molecular formula C7H17FN2
and a molecular weight of 148.23 g/mol. Its IUPAC name is N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine.
Molecular Properties
| Compound Name | N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine |
| PubChem CID | 167503143 |
| Molecular Formula | C7H17FN2 |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.14 |
| IUPAC Name | N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine |
| SMILES | CCCC(C)N(F)CNC |
| InChI | InChI=1S/C7H17FN2/c1-4-5-7(2)10(8)6-9-3/h7,9H,4-6H2,1-3H3 |
| InChIKey | KIPUVDCXQXTNNC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine?
The IUPAC name of N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine (CID 167503143) is N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine.
What is the SMILES notation for N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine?
The canonical SMILES for N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine is CCCC(C)N(F)CNC.
What is the InChIKey of N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine?
The InChIKey is KIPUVDCXQXTNNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17FN2/c1-4-5-7(2)10(8)6-9-3/h7,9H,4-6H2,1-3H3.
What are the key properties of N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine?
N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine has a molecular weight of 148.23 g/mol, XLogP of 1.54, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-fluoro-N-methyl-N'-pentan-2-ylmethanediamine is sourced from PubChem (CID 167503143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).