C5H13NO2 — CID 87329779
N,N-dihydroxypentan-2-amine (PubChem CID 87329779) has the molecular formula C5H13NO2 and a molecular weight of 119.16 g/mol. Its IUPAC name is N,N-dihydroxypentan-2-amine.
| Compound Name | N,N-dihydroxypentan-2-amine |
|---|---|
| PubChem CID | 87329779 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | N,N-dihydroxypentan-2-amine |
| SMILES | CCCC(C)N(O)O |
| InChI | InChI=1S/C5H13NO2/c1-3-4-5(2)6(7)8/h5,7-8H,3-4H2,1-2H3 |
| InChIKey | ANJJRHJKQHBYTM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|