C9H6ClFN2S — CID 167504159
5-(6-chloro-2-fluoro-3-pyridinyl)-2-methyl-1,3-thiazole (PubChem CID 167504159) has the molecular formula C9H6ClFN2S and a molecular weight of 228.68 g/mol. Its IUPAC name is 5-(6-chloro-2-fluoro-3-pyridinyl)-2-methyl-1,3-thiazole.
| Compound Name | 5-(6-chloro-2-fluoro-3-pyridinyl)-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 167504159 |
| Molecular Formula | C9H6ClFN2S |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 5-(6-chloro-2-fluoro-3-pyridinyl)-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(-c2ccc(Cl)nc2F)s1 |
| InChI | InChI=1S/C9H6ClFN2S/c1-5-12-4-7(14-5)6-2-3-8(10)13-9(6)11/h2-4H,1H3 |
| InChIKey | NFMCPLIPMXOBOG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|