C14H8BF3N2OS2 — CID 167506627
CID 167506627 (PubChem CID 167506627) has the molecular formula C14H8BF3N2OS2 and a molecular weight of 352.17 g/mol.
| Compound Name | CID 167506627 |
|---|---|
| PubChem CID | 167506627 |
| Molecular Formula | C14H8BF3N2OS2 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(-c2nc3cc(SC(F)(F)F)ccc3o2)c(SC)c1 |
| InChI | InChI=1S/C14H8BF3N2OS2/c1-22-11-4-7(15)6-19-12(11)13-20-9-5-8(23-14(16,17)18)2-3-10(9)21-13/h2-6H,1H3 |
| InChIKey | MOHFCBBAQFLVAG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|