C12H10N4OS — CID 167511144
3-(1H-imidazol-2-ylmethyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 167511144) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 3-(1H-imidazol-2-ylmethyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-(1H-imidazol-2-ylmethyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 167511144 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-(1H-imidazol-2-ylmethyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1Cc1ncc[nH]1 |
| InChI | InChI=1S/C12H10N4OS/c17-11-8-3-1-2-4-9(8)15-12(18)16(11)7-10-13-5-6-14-10/h1-6H,7H2,(H,13,14)(H,15,18) |
| InChIKey | IIEUPVBAPOUEGF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|