C18H15F4N5O2 — CID 167512030
6-(2-cyanoethylamino)-5-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-N-methylpyridine-3-carboxamide (PubChem CID 167512030) has the molecular formula C18H15F4N5O2 and a molecular weight of 409.34 g/mol. Its IUPAC name is 6-(2-cyanoethylamino)-5-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-(2-cyanoethylamino)-5-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 167512030 |
| Molecular Formula | C18H15F4N5O2 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 6-(2-cyanoethylamino)-5-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cnc(NCCC#N)c(NC(=O)c2cc(F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H15F4N5O2/c1-24-16(28)11-7-14(15(26-9-11)25-4-2-3-23)27-17(29)10-5-12(18(20,21)22)8-13(19)6-10/h5-9H,2,4H2,1H3,(H,24,28)(H,25,26)(H,27,29) |
| InChIKey | DPKDQDQBEDTRJU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|